About hept-1-yne-1,3-diol
hept-1-yne-1,3-diol (PubChem CID 18401946) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is hept-1-yne-1,3-diol.
Molecular Properties
| Compound Name | hept-1-yne-1,3-diol |
| PubChem CID | 18401946 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | hept-1-yne-1,3-diol |
| SMILES | CCCCC(O)C#CO |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-7(9)5-6-8/h7-9H,2-4H2,1H3 |
| InChIKey | LEWFFYUXJNVRHK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-1-yne-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-1-yne-1,3-diol?
The IUPAC name of hept-1-yne-1,3-diol (CID 18401946) is hept-1-yne-1,3-diol.
What is the SMILES notation for hept-1-yne-1,3-diol?
The canonical SMILES for hept-1-yne-1,3-diol is CCCCC(O)C#CO.
What is the InChIKey of hept-1-yne-1,3-diol?
The InChIKey is LEWFFYUXJNVRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-2-3-4-7(9)5-6-8/h7-9H,2-4H2,1H3.
What are the key properties of hept-1-yne-1,3-diol?
hept-1-yne-1,3-diol has a molecular weight of 128.17 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-1-yne-1,3-diol is sourced from PubChem (CID 18401946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).