C11H19NO4 — CID 166444620
N-methoxy-N,2-dimethyl-3-oxo-5-prop-2-enoxypentanamide (PubChem CID 166444620) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-methoxy-N,2-dimethyl-3-oxo-5-prop-2-enoxypentanamide.
| Compound Name | N-methoxy-N,2-dimethyl-3-oxo-5-prop-2-enoxypentanamide |
|---|---|
| PubChem CID | 166444620 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-methoxy-N,2-dimethyl-3-oxo-5-prop-2-enoxypentanamide |
| SMILES | C=CCOCCC(=O)C(C)C(=O)N(C)OC |
| InChI | InChI=1S/C11H19NO4/c1-5-7-16-8-6-10(13)9(2)11(14)12(3)15-4/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | LAUMWTXALFLECM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|