C16H29NO2 — CID 142240628
(E)-2-but-3-enyl-N-methoxy-N,3,7-trimethyloct-3-enamide (PubChem CID 142240628) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (E)-2-but-3-enyl-N-methoxy-N,3,7-trimethyloct-3-enamide.
| Compound Name | (E)-2-but-3-enyl-N-methoxy-N,3,7-trimethyloct-3-enamide |
|---|---|
| PubChem CID | 142240628 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (E)-2-but-3-enyl-N-methoxy-N,3,7-trimethyloct-3-enamide |
| SMILES | C=CCCC(C(=O)N(C)OC)/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C16H29NO2/c1-7-8-12-15(16(18)17(5)19-6)14(4)11-9-10-13(2)3/h7,11,13,15H,1,8-10,12H2,2-6H3/b14-11+ |
| InChIKey | WRDUSPNPGPTZFK-SDNWHVSQSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|