C18H38O2Si — CID 101227709
(E,2R,3R,6R)-2,4,6-trimethyl-3-triethylsilyloxynon-4-en-1-ol (PubChem CID 101227709) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is (E,2R,3R,6R)-2,4,6-trimethyl-3-triethylsilyloxynon-4-en-1-ol.
| Compound Name | (E,2R,3R,6R)-2,4,6-trimethyl-3-triethylsilyloxynon-4-en-1-ol |
|---|---|
| PubChem CID | 101227709 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (E,2R,3R,6R)-2,4,6-trimethyl-3-triethylsilyloxynon-4-en-1-ol |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@H](O[Si](CC)(CC)CC)[C@H](C)CO |
| InChI | InChI=1S/C18H38O2Si/c1-8-12-15(5)13-16(6)18(17(7)14-19)20-21(9-2,10-3)11-4/h13,15,17-19H,8-12,14H2,1-7H3/b16-13+/t15-,17-,18+/m1/s1 |
| InChIKey | JJCKRTAQDAILAZ-QQNZCSPNSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|