C14H30O3SSi — CID 101373373
[(E,3S,4S,7S)-3,5-dimethyl-7-methylsulfonyloct-5-en-4-yl]oxy-trimethylsilane (PubChem CID 101373373) has the molecular formula C14H30O3SSi and a molecular weight of 306.54 g/mol. Its IUPAC name is [(E,3S,4S,7S)-3,5-dimethyl-7-methylsulfonyloct-5-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E,3S,4S,7S)-3,5-dimethyl-7-methylsulfonyloct-5-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101373373 |
| Molecular Formula | C14H30O3SSi |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(E,3S,4S,7S)-3,5-dimethyl-7-methylsulfonyloct-5-en-4-yl]oxy-trimethylsilane |
| SMILES | CC[C@H](C)[C@H](O[Si](C)(C)C)/C(C)=C/[C@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C14H30O3SSi/c1-9-11(2)14(17-19(6,7)8)12(3)10-13(4)18(5,15)16/h10-11,13-14H,9H2,1-8H3/b12-10+/t11-,13-,14-/m0/s1 |
| InChIKey | ILYZRGQZLJXGFL-YEPKLUKZSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|