C18H32O3 — CID 11150636
(4E,6R,7R,8E,10R)-7-(methoxymethoxy)-6,8,10-trimethyltrideca-4,8-dienal (PubChem CID 11150636) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (4E,6R,7R,8E,10R)-7-(methoxymethoxy)-6,8,10-trimethyltrideca-4,8-dienal.
| Compound Name | (4E,6R,7R,8E,10R)-7-(methoxymethoxy)-6,8,10-trimethyltrideca-4,8-dienal |
|---|---|
| PubChem CID | 11150636 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (4E,6R,7R,8E,10R)-7-(methoxymethoxy)-6,8,10-trimethyltrideca-4,8-dienal |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@H](OCOC)[C@H](C)/C=C/CCC=O |
| InChI | InChI=1S/C18H32O3/c1-6-10-15(2)13-17(4)18(21-14-20-5)16(3)11-8-7-9-12-19/h8,11-13,15-16,18H,6-7,9-10,14H2,1-5H3/b11-8+,17-13+/t15-,16-,18-/m1/s1 |
| InChIKey | YHOOSSXQXICOHK-CFXDYJLXSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|