C27H50O3Sn — CID 15700072
(5E)-4-(methoxymethoxy)-10-tributylstannyltrideca-5,10,11-trienal (PubChem CID 15700072) has the molecular formula C27H50O3Sn and a molecular weight of 541.41 g/mol. Its IUPAC name is (5E)-4-(methoxymethoxy)-10-tributylstannyltrideca-5,10,11-trienal.
| Compound Name | (5E)-4-(methoxymethoxy)-10-tributylstannyltrideca-5,10,11-trienal |
|---|---|
| PubChem CID | 15700072 |
| Molecular Formula | C27H50O3Sn |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | (5E)-4-(methoxymethoxy)-10-tributylstannyltrideca-5,10,11-trienal |
| SMILES | CC=C=C(CCC/C=C/C(CCC=O)OCOC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H23O3.3C4H9.Sn/c1-3-4-5-6-7-8-9-11-15(12-10-13-16)18-14-17-2;3*1-3-4-2;/h3,9,11,13,15H,6-8,10,12,14H2,1-2H3;3*1,3-4H2,2H3;/b11-9+;;;; |
| InChIKey | RCYAQHSIWBHJNL-ARLMWRGNSA-N |
| XLogP | 8.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|