About 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol
3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol (PubChem CID 161465176) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol.
Molecular Properties
| Compound Name | 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol |
| PubChem CID | 161465176 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol |
| SMILES | C=CC(CCCCC)OCOC.C=CC(O)CCCCC |
| InChI | InChI=1S/C10H20O2.C8H16O/c1-4-6-7-8-10(5-2)12-9-11-3;1-3-5-6-7-8(9)4-2/h5,10H,2,4,6-9H2,1,3H3;4,8-9H,2-3,5-7H2,1H3 |
| InChIKey | WCIGFPDVMUBPQG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol?
The IUPAC name of 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol (CID 161465176) is 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol.
What is the SMILES notation for 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol?
The canonical SMILES for 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol is C=CC(CCCCC)OCOC.C=CC(O)CCCCC.
What is the InChIKey of 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol?
The InChIKey is WCIGFPDVMUBPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C8H16O/c1-4-6-7-8-10(5-2)12-9-11-3;1-3-5-6-7-8(9)4-2/h5,10H,2,4,6-9H2,1,3H3;4,8-9H,2-3,5-7H2,1H3.
What are the key properties of 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol?
3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol has a molecular weight of 300.48 g/mol, XLogP of 4.86, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethoxy)oct-1-ene;oct-1-en-3-ol is sourced from PubChem (CID 161465176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).