C27H54O3Sn — CID 16754601
(2R,6E,8R,9S,10Z)-8-(methoxymethoxy)-7,9-dimethyl-11-tributylstannylundeca-6,10-dien-2-ol (PubChem CID 16754601) has the molecular formula C27H54O3Sn and a molecular weight of 545.44 g/mol. Its IUPAC name is (2R,6E,8R,9S,10Z)-8-(methoxymethoxy)-7,9-dimethyl-11-tributylstannylundeca-6,10-dien-2-ol.
| Compound Name | (2R,6E,8R,9S,10Z)-8-(methoxymethoxy)-7,9-dimethyl-11-tributylstannylundeca-6,10-dien-2-ol |
|---|---|
| PubChem CID | 16754601 |
| Molecular Formula | C27H54O3Sn |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2R,6E,8R,9S,10Z)-8-(methoxymethoxy)-7,9-dimethyl-11-tributylstannylundeca-6,10-dien-2-ol |
| SMILES | CCCC[Sn](/C=C\[C@H](C)[C@@H](OCOC)/C(C)=C/CCC[C@@H](C)O)(CCCC)CCCC |
| InChI | InChI=1S/C15H27O3.3C4H9.Sn/c1-6-12(2)15(18-11-17-5)13(3)9-7-8-10-14(4)16;3*1-3-4-2;/h1,6,9,12,14-16H,7-8,10-11H2,2-5H3;3*1,3-4H2,2H3;/b6-1?,13-9+;;;;/t12-,14+,15+;;;;/m0..../s1 |
| InChIKey | IDLMCHRWLOFJKG-OKSXAZFMSA-N |
| XLogP | 8.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|