C28H54O5Sn — CID 11353793
methyl (Z,7R)-7-hydroxy-2-[(E,1R,2S)-1-(methoxymethoxy)-2-methyl-4-tributylstannylbut-3-enyl]oct-2-enoate (PubChem CID 11353793) has the molecular formula C28H54O5Sn and a molecular weight of 589.45 g/mol. Its IUPAC name is methyl (Z,7R)-7-hydroxy-2-[(E,1R,2S)-1-(methoxymethoxy)-2-methyl-4-tributylstannylbut-3-enyl]oct-2-enoate.
| Compound Name | methyl (Z,7R)-7-hydroxy-2-[(E,1R,2S)-1-(methoxymethoxy)-2-methyl-4-tributylstannylbut-3-enyl]oct-2-enoate |
|---|---|
| PubChem CID | 11353793 |
| Molecular Formula | C28H54O5Sn |
| Molecular Weight | 589.45 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | methyl (Z,7R)-7-hydroxy-2-[(E,1R,2S)-1-(methoxymethoxy)-2-methyl-4-tributylstannylbut-3-enyl]oct-2-enoate |
| SMILES | CCCC[Sn](/C=C/[C@H](C)[C@@H](OCOC)/C(=C/CCC[C@@H](C)O)C(=O)OC)(CCCC)CCCC |
| InChI | InChI=1S/C16H27O5.3C4H9.Sn/c1-6-12(2)15(21-11-19-4)14(16(18)20-5)10-8-7-9-13(3)17;3*1-3-4-2;/h1,6,10,12-13,15,17H,7-9,11H2,2-5H3;3*1,3-4H2,2H3;/b6-1?,14-10-;;;;/t12-,13+,15+;;;;/m0..../s1 |
| InChIKey | YVHXQUMQVWHYFU-RELFREDOSA-N |
| XLogP | 7.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.45 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|