C28H56O3Sn — CID 177472834
tributyl-[(1E,3S,5E,7S,8R,9R)-8-methoxy-9-(methoxymethoxy)-3,5,7-trimethyldeca-1,5-dienyl]stannane (PubChem CID 177472834) has the molecular formula C28H56O3Sn and a molecular weight of 559.46 g/mol. Its IUPAC name is tributyl-[(1E,3S,5E,7S,8R,9R)-8-methoxy-9-(methoxymethoxy)-3,5,7-trimethyldeca-1,5-dienyl]stannane.
| Compound Name | tributyl-[(1E,3S,5E,7S,8R,9R)-8-methoxy-9-(methoxymethoxy)-3,5,7-trimethyldeca-1,5-dienyl]stannane |
|---|---|
| PubChem CID | 177472834 |
| Molecular Formula | C28H56O3Sn |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | tributyl-[(1E,3S,5E,7S,8R,9R)-8-methoxy-9-(methoxymethoxy)-3,5,7-trimethyldeca-1,5-dienyl]stannane |
| SMILES | CCCC[Sn](/C=C/[C@@H](C)C/C(C)=C/[C@H](C)[C@@H](OC)[C@@H](C)OCOC)(CCCC)CCCC |
| InChI | InChI=1S/C16H29O3.3C4H9.Sn/c1-8-12(2)9-13(3)10-14(4)16(18-7)15(5)19-11-17-6;3*1-3-4-2;/h1,8,10,12,14-16H,9,11H2,2-7H3;3*1,3-4H2,2H3;/b8-1?,13-10+;;;;/t12-,14+,15-,16-;;;;/m1..../s1 |
| InChIKey | SAGSMHOHAQGUQQ-RKKBDLNKSA-N |
| XLogP | 8.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|