C30H43IO2Si — CID 16756481
tert-butyl-[(2S,3R,4S,5E,8S,9E)-10-iodo-3-methoxy-4,6,8-trimethyldeca-5,9-dien-2-yl]oxy-diphenylsilane (PubChem CID 16756481) has the molecular formula C30H43IO2Si and a molecular weight of 590.66 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4S,5E,8S,9E)-10-iodo-3-methoxy-4,6,8-trimethyldeca-5,9-dien-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3R,4S,5E,8S,9E)-10-iodo-3-methoxy-4,6,8-trimethyldeca-5,9-dien-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 16756481 |
| Molecular Formula | C30H43IO2Si |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | tert-butyl-[(2S,3R,4S,5E,8S,9E)-10-iodo-3-methoxy-4,6,8-trimethyldeca-5,9-dien-2-yl]oxy-diphenylsilane |
| SMILES | CO[C@@H]([C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)/C=C(\C)C[C@H](C)/C=C/I |
| InChI | InChI=1S/C30H43IO2Si/c1-23(19-20-31)21-24(2)22-25(3)29(32-8)26(4)33-34(30(5,6)7,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-20,22-23,25-26,29H,21H2,1-8H3/b20-19+,24-22+/t23-,25+,26+,29-/m1/s1 |
| InChIKey | YOASJLPHXIPIJL-AZZAGIQPSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|