C31H62O5Si3 — CID 101392092
methyl (2E,4R,6S,7E,9E)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-triethylsilyloxyundeca-2,7,9-trienoate (PubChem CID 101392092) has the molecular formula C31H62O5Si3 and a molecular weight of 599.09 g/mol. Its IUPAC name is methyl (2E,4R,6S,7E,9E)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-triethylsilyloxyundeca-2,7,9-trienoate.
| Compound Name | methyl (2E,4R,6S,7E,9E)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-triethylsilyloxyundeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 101392092 |
| Molecular Formula | C31H62O5Si3 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | methyl (2E,4R,6S,7E,9E)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-triethylsilyloxyundeca-2,7,9-trienoate |
| SMILES | CC[Si](CC)(CC)O[C@H](/C=C/C(C)=C/CO[Si](C)(C)C(C)(C)C)C[C@H](/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62O5Si3/c1-16-39(17-2,18-3)36-28(20-19-26(4)23-24-34-37(12,13)30(5,6)7)25-27(21-22-29(32)33-11)35-38(14,15)31(8,9)10/h19-23,27-28H,16-18,24-25H2,1-15H3/b20-19+,22-21+,26-23+/t27-,28+/m0/s1 |
| InChIKey | OXRHFPBONVKZDQ-YTUZLQAMSA-N |
| XLogP | 9.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|