C16H32O3Si — CID 56641063
ethyl (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate (PubChem CID 56641063) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is ethyl (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate.
| Compound Name | ethyl (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
|---|---|
| PubChem CID | 56641063 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethyl (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate |
| SMILES | CCCC[C@@H](/C=C\C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-8-10-11-14(12-13-15(17)18-9-2)19-20(6,7)16(3,4)5/h12-14H,8-11H2,1-7H3/b13-12-/t14-/m0/s1 |
| InChIKey | LZQZMMZILIKGAP-DINCDJDBSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|