C29H56O5Si2 — CID 11353231
methyl (2E,4R,5S,6S,7E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,9-dimethyl-6-tri(propan-2-yl)silyloxyundeca-2,7,9-trienoate (PubChem CID 11353231) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is methyl (2E,4R,5S,6S,7E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,9-dimethyl-6-tri(propan-2-yl)silyloxyundeca-2,7,9-trienoate.
| Compound Name | methyl (2E,4R,5S,6S,7E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,9-dimethyl-6-tri(propan-2-yl)silyloxyundeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 11353231 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | methyl (2E,4R,5S,6S,7E,9E)-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,9-dimethyl-6-tri(propan-2-yl)silyloxyundeca-2,7,9-trienoate |
| SMILES | COC(=O)/C=C/[C@@H](O)[C@H](C)[C@H](/C=C/C(C)=C/CO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H56O5Si2/c1-21(2)36(22(3)4,23(5)6)34-27(25(8)26(30)16-18-28(31)32-12)17-15-24(7)19-20-33-35(13,14)29(9,10)11/h15-19,21-23,25-27,30H,20H2,1-14H3/b17-15+,18-16+,24-19+/t25-,26+,27-/m0/s1 |
| InChIKey | FORCOLKTVMOLTM-JWHGVJEFSA-N |
| XLogP | 7.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|