C17H28O3 — CID 100990320
methyl (3S,4S,5E,7E)-4-hydroxy-3,5,7,9,9-pentamethyl-2-methylidenedeca-5,7-dienoate (PubChem CID 100990320) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl (3S,4S,5E,7E)-4-hydroxy-3,5,7,9,9-pentamethyl-2-methylidenedeca-5,7-dienoate.
| Compound Name | methyl (3S,4S,5E,7E)-4-hydroxy-3,5,7,9,9-pentamethyl-2-methylidenedeca-5,7-dienoate |
|---|---|
| PubChem CID | 100990320 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl (3S,4S,5E,7E)-4-hydroxy-3,5,7,9,9-pentamethyl-2-methylidenedeca-5,7-dienoate |
| SMILES | C=C(C(=O)OC)[C@H](C)[C@H](O)/C(C)=C/C(C)=C/C(C)(C)C |
| InChI | InChI=1S/C17H28O3/c1-11(10-17(5,6)7)9-12(2)15(18)13(3)14(4)16(19)20-8/h9-10,13,15,18H,4H2,1-3,5-8H3/b11-10+,12-9+/t13-,15+/m0/s1 |
| InChIKey | WTZRWZOQDYISBU-ZOBKZQINSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|