C14H26O2 — CID 23242851
(2S,3R,4E,6E)-2,4,6,8,8-pentamethylnona-4,6-diene-1,3-diol (PubChem CID 23242851) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2S,3R,4E,6E)-2,4,6,8,8-pentamethylnona-4,6-diene-1,3-diol.
| Compound Name | (2S,3R,4E,6E)-2,4,6,8,8-pentamethylnona-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 23242851 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (2S,3R,4E,6E)-2,4,6,8,8-pentamethylnona-4,6-diene-1,3-diol |
| SMILES | CC(=C\C(C)(C)C)/C=C(\C)[C@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C14H26O2/c1-10(8-14(4,5)6)7-11(2)13(16)12(3)9-15/h7-8,12-13,15-16H,9H2,1-6H3/b10-8+,11-7+/t12-,13-/m0/s1 |
| InChIKey | QMGMWOWUULULRJ-GJQYAJETSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|