C11H17IO3 — CID 71480975
methyl (3R,4E)-3-hydroxy-6-iodo-2,2,4-trimethylhepta-4,6-dienoate (PubChem CID 71480975) has the molecular formula C11H17IO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is methyl (3R,4E)-3-hydroxy-6-iodo-2,2,4-trimethylhepta-4,6-dienoate.
| Compound Name | methyl (3R,4E)-3-hydroxy-6-iodo-2,2,4-trimethylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 71480975 |
| Molecular Formula | C11H17IO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | methyl (3R,4E)-3-hydroxy-6-iodo-2,2,4-trimethylhepta-4,6-dienoate |
| SMILES | C=C(I)/C=C(\C)[C@@H](O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C11H17IO3/c1-7(6-8(2)12)9(13)11(3,4)10(14)15-5/h6,9,13H,2H2,1,3-5H3/b7-6+/t9-/m1/s1 |
| InChIKey | XUDMXXXUBYACCA-XCODYQFDSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|