C16H32O3 — CID 126628564
methyl (3S,5R,7S)-3-hydroxy-2,2,5,7,8,8-hexamethylnonanoate (PubChem CID 126628564) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is methyl (3S,5R,7S)-3-hydroxy-2,2,5,7,8,8-hexamethylnonanoate.
| Compound Name | methyl (3S,5R,7S)-3-hydroxy-2,2,5,7,8,8-hexamethylnonanoate |
|---|---|
| PubChem CID | 126628564 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | methyl (3S,5R,7S)-3-hydroxy-2,2,5,7,8,8-hexamethylnonanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](O)C[C@H](C)C[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3/c1-11(9-12(2)15(3,4)5)10-13(17)16(6,7)14(18)19-8/h11-13,17H,9-10H2,1-8H3/t11-,12+,13+/m1/s1 |
| InChIKey | IIIFSCBTEUYDFO-AGIUHOORSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |