methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate

C13H27NO2 — CID 83143662

IUPACmethyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate
SMILESCOC(=O)C(C)(C)CNCC(C)C(C)(C)C
InChIInChI=1S/C13H27NO2/c1-10(12(2,3)4)8-14-9-13(5,6)11(15)16-7/h10,14H,8-9H2,1-7H3
InChIKeyQXBLXBASIWOBDA-UHFFFAOYSA-N
MW229.36 g/mol
LogP2.46
Rot. Bonds5

About methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate

methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate (PubChem CID 83143662) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate
PubChem CID83143662
Molecular FormulaC13H27NO2
Molecular Weight229.36 g/mol
Exact Mass229.20
IUPAC Namemethyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate
SMILESCOC(=O)C(C)(C)CNCC(C)C(C)(C)C
InChIInChI=1S/C13H27NO2/c1-10(12(2,3)4)8-14-9-13(5,6)11(15)16-7/h10,14H,8-9H2,1-7H3
InChIKeyQXBLXBASIWOBDA-UHFFFAOYSA-N
XLogP2.46
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.36
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate?
The IUPAC name of methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate (CID 83143662) is methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate is COC(=O)C(C)(C)CNCC(C)C(C)(C)C.
What is the InChIKey of methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate?
The InChIKey is QXBLXBASIWOBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-10(12(2,3)4)8-14-9-13(5,6)11(15)16-7/h10,14H,8-9H2,1-7H3.
What are the key properties of methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate?
methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate has a molecular weight of 229.36 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-(2,3,3-trimethylbutylamino)propanoate is sourced from PubChem (CID 83143662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).