C13H26N2O3 — CID 103262309
methyl 2-acetamido-3-(2,3,3-trimethylbutylamino)propanoate (PubChem CID 103262309) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is methyl 2-acetamido-3-(2,3,3-trimethylbutylamino)propanoate.
| Compound Name | methyl 2-acetamido-3-(2,3,3-trimethylbutylamino)propanoate |
|---|---|
| PubChem CID | 103262309 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | methyl 2-acetamido-3-(2,3,3-trimethylbutylamino)propanoate |
| SMILES | COC(=O)C(CNCC(C)C(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C13H26N2O3/c1-9(13(3,4)5)7-14-8-11(12(17)18-6)15-10(2)16/h9,11,14H,7-8H2,1-6H3,(H,15,16) |
| InChIKey | MYBXPOYULALPDN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |