C13H25N3O4 — CID 103262789
methyl 2-acetamido-3-[[1-(tert-butylamino)-1-oxopropan-2-yl]amino]propanoate (PubChem CID 103262789) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 2-acetamido-3-[[1-(tert-butylamino)-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | methyl 2-acetamido-3-[[1-(tert-butylamino)-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 103262789 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | methyl 2-acetamido-3-[[1-(tert-butylamino)-1-oxopropan-2-yl]amino]propanoate |
| SMILES | COC(=O)C(CNC(C)C(=O)NC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C13H25N3O4/c1-8(11(18)16-13(3,4)5)14-7-10(12(19)20-6)15-9(2)17/h8,10,14H,7H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | BRTZMURWGJRBSF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |