C12H24N2O3 — CID 103254421
methyl 2-acetamido-3-(2,3-dimethylbutylamino)propanoate (PubChem CID 103254421) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl 2-acetamido-3-(2,3-dimethylbutylamino)propanoate.
| Compound Name | methyl 2-acetamido-3-(2,3-dimethylbutylamino)propanoate |
|---|---|
| PubChem CID | 103254421 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | methyl 2-acetamido-3-(2,3-dimethylbutylamino)propanoate |
| SMILES | COC(=O)C(CNCC(C)C(C)C)NC(C)=O |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)9(3)6-13-7-11(12(16)17-5)14-10(4)15/h8-9,11,13H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | ZFWGCELQVJHVQJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |