C36H76O6Si3 — CID 154713086
(E,4R,5S,7R,13R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxyoctadec-2-enoic acid (PubChem CID 154713086) has the molecular formula C36H76O6Si3 and a molecular weight of 689.26 g/mol. Its IUPAC name is (E,4R,5S,7R,13R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxyoctadec-2-enoic acid.
| Compound Name | (E,4R,5S,7R,13R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxyoctadec-2-enoic acid |
|---|---|
| PubChem CID | 154713086 |
| Molecular Formula | C36H76O6Si3 |
| Molecular Weight | 689.26 g/mol |
| Exact Mass | 688.49 |
| IUPAC Name | (E,4R,5S,7R,13R)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxyoctadec-2-enoic acid |
| SMILES | CCCCC[C@@H](O)CCCCC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H76O6Si3/c1-17-18-20-23-29(37)24-21-19-22-25-30(40-43(11,12)34(2,3)4)28-32(42-45(15,16)36(8,9)10)31(26-27-33(38)39)41-44(13,14)35(5,6)7/h26-27,29-32,37H,17-25,28H2,1-16H3,(H,38,39)/b27-26+/t29-,30-,31-,32+/m1/s1 |
| InChIKey | ONZOAVKKQFDNQF-GMVJMEOMSA-N |
| XLogP | 11.08 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.26 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|