C17H34O6Si — CID 135015587
ethyl (E,6S,7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8,9-trihydroxynon-2-enoate (PubChem CID 135015587) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is ethyl (E,6S,7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8,9-trihydroxynon-2-enoate.
| Compound Name | ethyl (E,6S,7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8,9-trihydroxynon-2-enoate |
|---|---|
| PubChem CID | 135015587 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | ethyl (E,6S,7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8,9-trihydroxynon-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H34O6Si/c1-7-22-15(20)11-9-8-10-14(16(21)13(19)12-18)23-24(5,6)17(2,3)4/h9,11,13-14,16,18-19,21H,7-8,10,12H2,1-6H3/b11-9+/t13-,14+,16+/m1/s1 |
| InChIKey | MADASSPDKRURKX-SFXARFFLSA-N |
| XLogP | 1.99 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|