C37H70O5Si3 — CID 11468081
(2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid (PubChem CID 11468081) has the molecular formula C37H70O5Si3 and a molecular weight of 679.22 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 11468081 |
| Molecular Formula | C37H70O5Si3 |
| Molecular Weight | 679.22 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoic acid |
| SMILES | CC(=C\C=C\C(C)=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)/C=C(C)/C=C/C(=O)O |
| InChI | InChI=1S/C37H70O5Si3/c1-28(25-30(3)23-24-34(38)39)21-20-22-29(2)26-32(41-44(16,17)36(8,9)10)33(42-45(18,19)37(11,12)13)27-31(4)40-43(14,15)35(5,6)7/h20-26,31-33H,27H2,1-19H3,(H,38,39)/b22-20+,24-23+,28-21+,29-26+,30-25+/t31-,32-,33-/m0/s1 |
| InChIKey | JFKMSSIZHVBTTO-TYOYTEFNSA-N |
| XLogP | 11.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.22 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|