C40H86O6Si3Sn — CID 139249824
methyl (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-enoate (PubChem CID 139249824) has the molecular formula C40H86O6Si3Sn and a molecular weight of 866.09 g/mol. Its IUPAC name is methyl (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-enoate.
| Compound Name | methyl (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-enoate |
|---|---|
| PubChem CID | 139249824 |
| Molecular Formula | C40H86O6Si3Sn |
| Molecular Weight | 866.09 g/mol |
| Exact Mass | 866.48 |
| IUPAC Name | methyl (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(=O)OC)C[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H59O6Si3.3C4H9.Sn/c1-23(33-36(12,13)27(2,3)4)25(32-22-31-19-20-35(9,10)11)21-24(17-16-18-26(29)30-8)34-37(14,15)28(5,6)7;3*1-3-4-2;/h18,23-25H,17,19-22H2,1-15H3;3*1,3-4H2,2H3;/t23-,24+,25-;;;;/m1..../s1 |
| InChIKey | ZFMTYNHDWODGMC-WYFKOZGKSA-N |
| XLogP | 12.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.09 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|