C31H62F2O6Si3 — CID 132603405
methyl (E,5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(1,1-difluoroprop-2-enyl)-7-(2-trimethylsilylethoxymethoxy)non-2-enoate (PubChem CID 132603405) has the molecular formula C31H62F2O6Si3 and a molecular weight of 653.09 g/mol. Its IUPAC name is methyl (E,5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(1,1-difluoroprop-2-enyl)-7-(2-trimethylsilylethoxymethoxy)non-2-enoate.
| Compound Name | methyl (E,5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(1,1-difluoroprop-2-enyl)-7-(2-trimethylsilylethoxymethoxy)non-2-enoate |
|---|---|
| PubChem CID | 132603405 |
| Molecular Formula | C31H62F2O6Si3 |
| Molecular Weight | 653.09 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | methyl (E,5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(1,1-difluoroprop-2-enyl)-7-(2-trimethylsilylethoxymethoxy)non-2-enoate |
| SMILES | C=CC(F)(F)/C(=C/C(=O)OC)C[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62F2O6Si3/c1-17-31(32,33)25(21-28(34)35-9)20-26(39-42(15,16)30(6,7)8)22-27(37-23-36-18-19-40(10,11)12)24(2)38-41(13,14)29(3,4)5/h17,21,24,26-27H,1,18-20,22-23H2,2-16H3/b25-21+/t24-,26+,27-/m1/s1 |
| InChIKey | YMRBVQAVTBYGPG-SZIYJKTBSA-N |
| XLogP | 9.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.09 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|