C22H42O7Si — CID 11683781
(2R)-2-[(1R,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(methoxymethoxy)heptyl]-2,3-dihydropyran-6-one (PubChem CID 11683781) has the molecular formula C22H42O7Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(methoxymethoxy)heptyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1R,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(methoxymethoxy)heptyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11683781 |
| Molecular Formula | C22H42O7Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-2-[(1R,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(methoxymethoxy)heptyl]-2,3-dihydropyran-6-one |
| SMILES | CCCC[C@H](OCOC)[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C22H42O7Si/c1-9-10-12-17(26-15-24-5)20(27-16-25-6)21(18-13-11-14-19(23)28-18)29-30(7,8)22(2,3)4/h11,14,17-18,20-21H,9-10,12-13,15-16H2,1-8H3/t17-,18+,20+,21+/m0/s1 |
| InChIKey | WQZWKRSVBYIXNV-UYWIDEMCSA-N |
| XLogP | 4.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|