C18H32O5Si — CID 11760087
(13Z)-7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradec-13-en-12-one (PubChem CID 11760087) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is (13Z)-7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradec-13-en-12-one.
| Compound Name | (13Z)-7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradec-13-en-12-one |
|---|---|
| PubChem CID | 11760087 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (13Z)-7-[tert-butyl(dimethyl)silyl]oxy-10-methyl-1,4,11-trioxaspiro[4.9]tetradec-13-en-12-one |
| SMILES | CC1CCC(O[Si](C)(C)C(C)(C)C)CC2(/C=C\C(=O)O1)OCCO2 |
| InChI | InChI=1S/C18H32O5Si/c1-14-7-8-15(23-24(5,6)17(2,3)4)13-18(20-11-12-21-18)10-9-16(19)22-14/h9-10,14-15H,7-8,11-13H2,1-6H3/b10-9- |
| InChIKey | HTJCJRVWQQQSDS-KTKRTIGZSA-N |
| XLogP | 3.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|