C31H60O7Si — CID 138967741
ethyl (E)-3-[(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 138967741) has the molecular formula C31H60O7Si and a molecular weight of 572.90 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 138967741 |
| Molecular Formula | C31H60O7Si |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | ethyl (E)-3-[(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCCCC[C@H](CCCCC[C@H](C[C@@H]1OC(C)(C)O[C@@H]1/C=C/C(=O)OCC)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H60O7Si/c1-11-13-15-18-25(38-39(9,10)30(3,4)5)19-16-14-17-20-26(35-24-33-8)23-28-27(36-31(6,7)37-28)21-22-29(32)34-12-2/h21-22,25-28H,11-20,23-24H2,1-10H3/b22-21+/t25-,26-,27-,28+/m1/s1 |
| InChIKey | SKSFEXNZOQSFTQ-KEZROHTRSA-N |
| XLogP | 7.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|