C23H44O5Si — CID 135024773
ethyl (Z)-3-[(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 135024773) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is ethyl (Z)-3-[(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135024773 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | ethyl (Z)-3-[(4S,5R)-5-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@H]1OC(C)(C)O[C@@H]1CCCCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-10-25-21(24)17-16-20-19(26-23(6,7)27-20)15-13-11-12-14-18(2)28-29(8,9)22(3,4)5/h16-20H,10-15H2,1-9H3/b17-16-/t18-,19+,20-/m0/s1 |
| InChIKey | RRGNUBUUERZTPS-DLIMNBRQSA-N |
| XLogP | 5.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|