C27H50O6Si2 — CID 11016851
(2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 11016851) has the molecular formula C27H50O6Si2 and a molecular weight of 526.86 g/mol. Its IUPAC name is (2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11016851 |
| Molecular Formula | C27H50O6Si2 |
| Molecular Weight | 526.86 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@H](/C=C/[C@@H]1CC=CC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O6Si2/c1-19(32-34(10,11)25(2,3)4)23-24(31-27(8,9)30-23)21(33-35(12,13)26(5,6)7)18-17-20-15-14-16-22(28)29-20/h14,16-21,23-24H,15H2,1-13H3/b18-17+/t19-,20-,21-,23-,24-/m0/s1 |
| InChIKey | ODYXGWBQIXQBDY-FEGAXPBTSA-N |
| XLogP | 6.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.86 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|