C20H38O6Si — CID 10644824
ethyl (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate (PubChem CID 10644824) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is ethyl (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate.
| Compound Name | ethyl (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 10644824 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | ethyl (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C[C@H](C[C@H]1COC(C)(C)O1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C20H38O6Si/c1-8-23-19(21)16(2)9-10-17(13-18-14-25-20(3,4)26-18)24-15-22-11-12-27(5,6)7/h9,17-18H,8,10-15H2,1-7H3/b16-9+/t17-,18+/m1/s1 |
| InChIKey | YDEUEUXXUHWXCR-BIJQAGJASA-N |
| XLogP | 4.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|