C29H54O6Si2 — CID 10951813
[(4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-4-yl] prop-2-enoate (PubChem CID 10951813) has the molecular formula C29H54O6Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is [(4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-4-yl] prop-2-enoate.
| Compound Name | [(4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 10951813 |
| Molecular Formula | C29H54O6Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | [(4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@H](C)O[Si](C)(C)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C29H54O6Si2/c1-16-18-22(31-24(30)17-2)19-20-23(35-37(14,15)28(7,8)9)26-25(32-29(10,11)33-26)21(3)34-36(12,13)27(4,5)6/h16-17,19-23,25-26H,1-2,18H2,3-15H3/b20-19+/t21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | NQMQLEWZNHKULY-GQBACFOISA-N |
| XLogP | 7.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|