C19H34O4Si — CID 10736878
(1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-2-one (PubChem CID 10736878) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-2-one.
| Compound Name | (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-2-one |
|---|---|
| PubChem CID | 10736878 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (1R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-2-one |
| SMILES | C=CCCC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C19H34O4Si/c1-10-12-13-14(20)16(23-24(8,9)18(3,4)5)17-15(11-2)21-19(6,7)22-17/h10-11,15-17H,1-2,12-13H2,3-9H3/t15-,16-,17-/m0/s1 |
| InChIKey | TYXZUKUZXGRSRP-ULQDDVLXSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|