C24H46O7Si — CID 11317490
[(4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-yl] prop-2-enoate (PubChem CID 11317490) has the molecular formula C24H46O7Si and a molecular weight of 474.71 g/mol. Its IUPAC name is [(4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11317490 |
| Molecular Formula | C24H46O7Si |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [(4R,5R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-bis(methoxymethoxy)undec-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCC)OCOC |
| InChI | InChI=1S/C24H46O7Si/c1-11-14-16-19(28-17-26-7)23(31-32(9,10)24(4,5)6)22(29-18-27-8)20(15-12-2)30-21(25)13-3/h12-13,19-20,22-23H,2-3,11,14-18H2,1,4-10H3/t19-,20+,22+,23+/m0/s1 |
| InChIKey | DWAJVQZKCSPGRF-KKSHJYNMSA-N |
| XLogP | 5.22 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|