C24H44O8 — CID 155935154
[(2R,3S,12S,13R)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl] prop-2-enoate (PubChem CID 155935154) has the molecular formula C24H44O8 and a molecular weight of 460.61 g/mol. Its IUPAC name is [(2R,3S,12S,13R)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl] prop-2-enoate.
| Compound Name | [(2R,3S,12S,13R)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 155935154 |
| Molecular Formula | C24H44O8 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | [(2R,3S,12S,13R)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](C)[C@H](CCCCCCCC[C@H](OCOC)[C@@H](C=C)OCOC)OCOC |
| InChI | InChI=1S/C24H44O8/c1-7-21(29-17-26-4)23(31-19-28-6)16-14-12-10-9-11-13-15-22(30-18-27-5)20(3)32-24(25)8-2/h7-8,20-23H,1-2,9-19H2,3-6H3/t20-,21-,22+,23+/m1/s1 |
| InChIKey | HPAUNAIRAMELAF-LUKWVAJMSA-N |
| XLogP | 4.38 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|