C23H40O6 — CID 138967742
(1R,2E,6R,12R,14S)-12-(methoxymethoxy)-16,16-dimethyl-6-pentyl-5,15,17-trioxabicyclo[12.3.0]heptadec-2-en-4-one (PubChem CID 138967742) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (1R,2E,6R,12R,14S)-12-(methoxymethoxy)-16,16-dimethyl-6-pentyl-5,15,17-trioxabicyclo[12.3.0]heptadec-2-en-4-one.
| Compound Name | (1R,2E,6R,12R,14S)-12-(methoxymethoxy)-16,16-dimethyl-6-pentyl-5,15,17-trioxabicyclo[12.3.0]heptadec-2-en-4-one |
|---|---|
| PubChem CID | 138967742 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1R,2E,6R,12R,14S)-12-(methoxymethoxy)-16,16-dimethyl-6-pentyl-5,15,17-trioxabicyclo[12.3.0]heptadec-2-en-4-one |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](OCOC)C[C@@H]2OC(C)(C)O[C@@H]2/C=C/C(=O)O1 |
| InChI | InChI=1S/C23H40O6/c1-5-6-8-11-18-12-9-7-10-13-19(26-17-25-4)16-21-20(14-15-22(24)27-18)28-23(2,3)29-21/h14-15,18-21H,5-13,16-17H2,1-4H3/b15-14+/t18-,19-,20-,21+/m1/s1 |
| InChIKey | GAVOPJGHYLGIFD-LUOAJIDZSA-N |
| XLogP | 4.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|