C18H30O6 — CID 11336816
(1S,2E,6R,12S,14R,15R)-14,15-dimethoxy-6,14,15-trimethyl-5,13,16-trioxabicyclo[10.4.0]hexadec-2-en-4-one (PubChem CID 11336816) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (1S,2E,6R,12S,14R,15R)-14,15-dimethoxy-6,14,15-trimethyl-5,13,16-trioxabicyclo[10.4.0]hexadec-2-en-4-one.
| Compound Name | (1S,2E,6R,12S,14R,15R)-14,15-dimethoxy-6,14,15-trimethyl-5,13,16-trioxabicyclo[10.4.0]hexadec-2-en-4-one |
|---|---|
| PubChem CID | 11336816 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (1S,2E,6R,12S,14R,15R)-14,15-dimethoxy-6,14,15-trimethyl-5,13,16-trioxabicyclo[10.4.0]hexadec-2-en-4-one |
| SMILES | CO[C@]1(C)O[C@H]2/C=C/C(=O)O[C@H](C)CCCCC[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C18H30O6/c1-13-9-7-6-8-10-14-15(11-12-16(19)22-13)24-18(3,21-5)17(2,20-4)23-14/h11-15H,6-10H2,1-5H3/b12-11+/t13-,14+,15+,17-,18-/m1/s1 |
| InChIKey | CCDWCQAYTGPTII-OLOAOWNZSA-N |
| XLogP | 2.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |