C20H34O8 — CID 53362387
[(4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-yl] prop-2-enoate (PubChem CID 53362387) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is [(4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-yl] prop-2-enoate.
| Compound Name | [(4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 53362387 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [(4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](/C=C/C[C@@H](OCOC)[C@H](OCOC)[C@@H](C)OCOC)OC(=O)C=C |
| InChI | InChI=1S/C20H34O8/c1-7-10-17(28-19(21)8-2)11-9-12-18(26-14-23-5)20(27-15-24-6)16(3)25-13-22-4/h7-9,11,16-18,20H,1-2,10,12-15H2,3-6H3/b11-9+/t16-,17-,18-,20-/m1/s1 |
| InChIKey | JZSDHPSXRDTBLN-QSMSFLDSSA-N |
| XLogP | 2.59 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|