C20H30O8 — CID 11079842
[(4R,5R,6R,7S)-5,6,7-triacetyloxyundec-1-en-4-yl] prop-2-enoate (PubChem CID 11079842) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is [(4R,5R,6R,7S)-5,6,7-triacetyloxyundec-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,5R,6R,7S)-5,6,7-triacetyloxyundec-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11079842 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(4R,5R,6R,7S)-5,6,7-triacetyloxyundec-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](CCCC)OC(C)=O |
| InChI | InChI=1S/C20H30O8/c1-7-10-12-17(25-13(4)21)20(27-15(6)23)19(26-14(5)22)16(11-8-2)28-18(24)9-3/h8-9,16-17,19-20H,2-3,7,10-12H2,1,4-6H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | YJVUKDRZIFQDOA-PIKOESSRSA-N |
| XLogP | 2.65 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|