C20H36O6 — CID 134853334
[(2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-yl] prop-2-enoate (PubChem CID 134853334) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is [(2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-yl] prop-2-enoate.
| Compound Name | [(2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 134853334 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | [(2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](C)CCCCC[C@@H](CC[C@@H](C=C)OCOC)OCOC |
| InChI | InChI=1S/C20H36O6/c1-6-18(24-15-22-4)13-14-19(25-16-23-5)12-10-8-9-11-17(3)26-20(21)7-2/h6-7,17-19H,1-2,8-16H2,3-5H3/t17-,18+,19-/m0/s1 |
| InChIKey | LEBSDGKHZSYKGW-OTWHNJEPSA-N |
| XLogP | 4.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|