C27H56O7Si — CID 155935158
tert-butyl-dimethyl-[(2R,3S,12S,13S)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl]oxysilane (PubChem CID 155935158) has the molecular formula C27H56O7Si and a molecular weight of 520.82 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3S,12S,13S)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3S,12S,13S)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 155935158 |
| Molecular Formula | C27H56O7Si |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3S,12S,13S)-3,12,13-tris(methoxymethoxy)pentadec-14-en-2-yl]oxysilane |
| SMILES | C=C[C@H](OCOC)[C@H](CCCCCCCC[C@H](OCOC)[C@@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C27H56O7Si/c1-11-24(31-20-28-6)26(33-22-30-8)19-17-15-13-12-14-16-18-25(32-21-29-7)23(2)34-35(9,10)27(3,4)5/h11,23-26H,1,12-22H2,2-10H3/t23-,24+,25+,26+/m1/s1 |
| InChIKey | FOAQGFJCGRCBKW-RSYZFUPGSA-N |
| XLogP | 6.67 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|