C25H52O6Si — CID 155935157
(3S,4S,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4,13-bis(methoxymethoxy)pentadec-1-en-3-ol (PubChem CID 155935157) has the molecular formula C25H52O6Si and a molecular weight of 476.77 g/mol. Its IUPAC name is (3S,4S,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4,13-bis(methoxymethoxy)pentadec-1-en-3-ol.
| Compound Name | (3S,4S,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4,13-bis(methoxymethoxy)pentadec-1-en-3-ol |
|---|---|
| PubChem CID | 155935157 |
| Molecular Formula | C25H52O6Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | (3S,4S,13S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4,13-bis(methoxymethoxy)pentadec-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@H](CCCCCCCC[C@H](OCOC)[C@@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C25H52O6Si/c1-10-22(26)24(30-20-28-7)18-16-14-12-11-13-15-17-23(29-19-27-6)21(2)31-32(8,9)25(3,4)5/h10,21-24,26H,1,11-20H2,2-9H3/t21-,22+,23+,24+/m1/s1 |
| InChIKey | XLGPJGZXHNNTIJ-SBFWRKJZSA-N |
| XLogP | 6.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|