C18H38O4Si — CID 46850136
(4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol (PubChem CID 46850136) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol.
| Compound Name | (4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol |
|---|---|
| PubChem CID | 46850136 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-en-1-ol |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCCO)OCOC |
| InChI | InChI=1S/C18H38O4Si/c1-9-17(18(11-10-12-19)21-13-20-8)22-23(14(2)3,15(4)5)16(6)7/h9,14-19H,1,10-13H2,2-8H3/t17-,18-/m0/s1 |
| InChIKey | WPYFQRDQHZBBCQ-ROUUACIJSA-N |
| XLogP | 4.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|