C24H52O4Si2 — CID 139252210
tert-butyl-[(4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]-dimethylsilane (PubChem CID 139252210) has the molecular formula C24H52O4Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is tert-butyl-[(4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 139252210 |
| Molecular Formula | C24H52O4Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | tert-butyl-[(4S,5S)-4-(methoxymethoxy)-5-tri(propan-2-yl)silyloxyhept-6-enoxy]-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCCO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C24H52O4Si2/c1-14-22(28-30(19(2)3,20(4)5)21(6)7)23(26-18-25-11)16-15-17-27-29(12,13)24(8,9)10/h14,19-23H,1,15-18H2,2-13H3/t22-,23-/m0/s1 |
| InChIKey | CKNNHGOVLBPJPA-GOTSBHOMSA-N |
| XLogP | 7.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|