C19H40O4Si — CID 56838093
(3S,4S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)undec-1-en-4-ol (PubChem CID 56838093) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (3S,4S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)undec-1-en-4-ol.
| Compound Name | (3S,4S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)undec-1-en-4-ol |
|---|---|
| PubChem CID | 56838093 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3S,4S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)undec-1-en-4-ol |
| SMILES | C=C[C@H](OCOC)[C@@H](O)CCCCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-9-18(22-15-21-6)17(20)14-12-10-11-13-16(2)23-24(7,8)19(3,4)5/h9,16-18,20H,1,10-15H2,2-8H3/t16-,17-,18-/m0/s1 |
| InChIKey | FLTQWLNANZMVBK-BZSNNMDCSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|