C20H36O5Si — CID 11222860
[(1R)-1-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate (PubChem CID 11222860) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is [(1R)-1-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate.
| Compound Name | [(1R)-1-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 11222860 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(1R)-1-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@H]1OC(C)(C)O[C@H]1[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O5Si/c1-11-13-16(22-14(3)21)18-17(23-20(7,8)24-18)15(12-2)25-26(9,10)19(4,5)6/h11-12,15-18H,1-2,13H2,3-10H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | RKEFTZHFHUHSCG-ZJPYXAASSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|