C28H52O5Si — CID 67706617
(5Z,10E,12S)-12-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)heptadeca-5,10-dienoic acid (PubChem CID 67706617) has the molecular formula C28H52O5Si and a molecular weight of 496.81 g/mol. Its IUPAC name is (5Z,10E,12S)-12-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)heptadeca-5,10-dienoic acid.
| Compound Name | (5Z,10E,12S)-12-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)heptadeca-5,10-dienoic acid |
|---|---|
| PubChem CID | 67706617 |
| Molecular Formula | C28H52O5Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | (5Z,10E,12S)-12-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)heptadeca-5,10-dienoic acid |
| SMILES | CCCCC[C@@H](/C=C/CCC/C=C\CCC(C(=O)O)C1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O5Si/c1-9-10-16-19-23(33-34(7,8)27(2,3)4)20-17-14-12-11-13-15-18-21-24(26(29)30)25-22-31-28(5,6)32-25/h13,15,17,20,23-25H,9-12,14,16,18-19,21-22H2,1-8H3,(H,29,30)/b15-13-,20-17+/t23-,24?,25?/m0/s1 |
| InChIKey | XNBZQGAMUMKRSU-KHQONCPDSA-N |
| XLogP | 7.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|